C21H31FO4 — CID 70611161
(8S,9R,10S,13S,14S,17S)-9-fluoro-17-(2-hydroxyethyl)-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydro-3H-cyclopenta[a]phenanthrene-11,16,17-triol (PubChem CID 70611161) has the molecular formula C21H31FO4 and a molecular weight of 366.47 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S,17S)-9-fluoro-17-(2-hydroxyethyl)-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydro-3H-cyclopenta[a]phenanthrene-11,16,17-triol.
| Compound Name | (8S,9R,10S,13S,14S,17S)-9-fluoro-17-(2-hydroxyethyl)-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydro-3H-cyclopenta[a]phenanthrene-11,16,17-triol |
|---|---|
| PubChem CID | 70611161 |
| Molecular Formula | C21H31FO4 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (8S,9R,10S,13S,14S,17S)-9-fluoro-17-(2-hydroxyethyl)-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydro-3H-cyclopenta[a]phenanthrene-11,16,17-triol |
| SMILES | C[C@]12C=CCC=C1CC[C@H]1[C@@H]3CC(O)[C@](O)(CCO)[C@@]3(C)CC(O)[C@@]12F |
| InChI | InChI=1S/C21H31FO4/c1-18-8-4-3-5-13(18)6-7-14-15-11-16(24)20(26,9-10-23)19(15,2)12-17(25)21(14,18)22/h4-5,8,14-17,23-26H,3,6-7,9-12H2,1-2H3/t14-,15-,16?,17?,18-,19-,20+,21-/m0/s1 |
| InChIKey | CDZHMCAGVBPJHC-PXXITWEHSA-N |
| XLogP | 2.26 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|