C31H39FN2O3S — CID 123490902
9-fluoro-17-[2-[(4-methoxyphenyl)methylamino]-1,3-thiazol-4-yl]-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydro-3H-cyclopenta[a]phenanthrene-11,17-diol (PubChem CID 123490902) has the molecular formula C31H39FN2O3S and a molecular weight of 538.73 g/mol. Its IUPAC name is 9-fluoro-17-[2-[(4-methoxyphenyl)methylamino]-1,3-thiazol-4-yl]-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydro-3H-cyclopenta[a]phenanthrene-11,17-diol.
| Compound Name | 9-fluoro-17-[2-[(4-methoxyphenyl)methylamino]-1,3-thiazol-4-yl]-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydro-3H-cyclopenta[a]phenanthrene-11,17-diol |
|---|---|
| PubChem CID | 123490902 |
| Molecular Formula | C31H39FN2O3S |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 9-fluoro-17-[2-[(4-methoxyphenyl)methylamino]-1,3-thiazol-4-yl]-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydro-3H-cyclopenta[a]phenanthrene-11,17-diol |
| SMILES | COc1ccc(CNc2nc(C3(O)C(C)CC4C5CCC6=CCC=CC6(C)C5(F)C(O)CC43C)cs2)cc1 |
| InChI | InChI=1S/C31H39FN2O3S/c1-19-15-24-23-13-10-21-7-5-6-14-28(21,2)30(23,32)26(35)16-29(24,3)31(19,36)25-18-38-27(34-25)33-17-20-8-11-22(37-4)12-9-20/h6-9,11-12,14,18-19,23-24,26,35-36H,5,10,13,15-17H2,1-4H3,(H,33,34) |
| InChIKey | LYNKRGROMRNJSC-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|