C34H51FO8 — CID 91234888
[9-fluoro-11-hydroxy-10,13,16-trimethyl-17-[2-[2-(2-propoxyethoxy)acetyl]oxyacetyl]-6,7,8,11,12,14,15,16-octahydro-3H-cyclopenta[a]phenanthren-17-yl] pentanoate (PubChem CID 91234888) has the molecular formula C34H51FO8 and a molecular weight of 606.77 g/mol. Its IUPAC name is [9-fluoro-11-hydroxy-10,13,16-trimethyl-17-[2-[2-(2-propoxyethoxy)acetyl]oxyacetyl]-6,7,8,11,12,14,15,16-octahydro-3H-cyclopenta[a]phenanthren-17-yl] pentanoate.
| Compound Name | [9-fluoro-11-hydroxy-10,13,16-trimethyl-17-[2-[2-(2-propoxyethoxy)acetyl]oxyacetyl]-6,7,8,11,12,14,15,16-octahydro-3H-cyclopenta[a]phenanthren-17-yl] pentanoate |
|---|---|
| PubChem CID | 91234888 |
| Molecular Formula | C34H51FO8 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.36 |
| IUPAC Name | [9-fluoro-11-hydroxy-10,13,16-trimethyl-17-[2-[2-(2-propoxyethoxy)acetyl]oxyacetyl]-6,7,8,11,12,14,15,16-octahydro-3H-cyclopenta[a]phenanthren-17-yl] pentanoate |
| SMILES | CCCCC(=O)OC1(C(=O)COC(=O)COCCOCCC)C(C)CC2C3CCC4=CCC=CC4(C)C3(F)C(O)CC21C |
| InChI | InChI=1S/C34H51FO8/c1-6-8-12-29(38)43-34(28(37)21-42-30(39)22-41-18-17-40-16-7-2)23(3)19-26-25-14-13-24-11-9-10-15-31(24,4)33(25,35)27(36)20-32(26,34)5/h10-11,15,23,25-27,36H,6-9,12-14,16-22H2,1-5H3 |
| InChIKey | LDBWTXQBGIYIHF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|