C27H35FI2O5 — CID 88668948
[(8S,9R,10S,13S,14S,17R)-17-(2,2-diiodoacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate (PubChem CID 88668948) has the molecular formula C27H35FI2O5 and a molecular weight of 712.38 g/mol. Its IUPAC name is [(8S,9R,10S,13S,14S,17R)-17-(2,2-diiodoacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate.
| Compound Name | [(8S,9R,10S,13S,14S,17R)-17-(2,2-diiodoacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
|---|---|
| PubChem CID | 88668948 |
| Molecular Formula | C27H35FI2O5 |
| Molecular Weight | 712.38 g/mol |
| Exact Mass | 712.06 |
| IUPAC Name | [(8S,9R,10S,13S,14S,17R)-17-(2,2-diiodoacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
| SMILES | CCCCC(=O)O[C@]1(C(=O)C(I)I)C(C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)C(O)C[C@@]21C |
| InChI | InChI=1S/C27H35FI2O5/c1-5-6-7-21(33)35-27(22(34)23(29)30)15(2)12-19-18-9-8-16-13-17(31)10-11-24(16,3)26(18,28)20(32)14-25(19,27)4/h10-11,13,15,18-20,23,32H,5-9,12,14H2,1-4H3/t15?,18-,19-,20?,24-,25-,26-,27-/m0/s1 |
| InChIKey | JEZXAOUYFKGECF-ICDODZENSA-N |
| XLogP | 5.84 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.38 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|