C26H34ClFO6 — CID 88801636
[(8S,9R,10S,11S,13S,14S,16R,17R)-17-(2-chloro-2-hydroxyacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] butanoate (PubChem CID 88801636) has the molecular formula C26H34ClFO6 and a molecular weight of 497.00 g/mol. Its IUPAC name is [(8S,9R,10S,11S,13S,14S,16R,17R)-17-(2-chloro-2-hydroxyacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] butanoate.
| Compound Name | [(8S,9R,10S,11S,13S,14S,16R,17R)-17-(2-chloro-2-hydroxyacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] butanoate |
|---|---|
| PubChem CID | 88801636 |
| Molecular Formula | C26H34ClFO6 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | [(8S,9R,10S,11S,13S,14S,16R,17R)-17-(2-chloro-2-hydroxyacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] butanoate |
| SMILES | CCCC(=O)O[C@]1(C(=O)C(O)Cl)[C@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C26H34ClFO6/c1-5-6-20(31)34-26(21(32)22(27)33)14(2)11-18-17-8-7-15-12-16(29)9-10-23(15,3)25(17,28)19(30)13-24(18,26)4/h9-10,12,14,17-19,22,30,33H,5-8,11,13H2,1-4H3/t14-,17+,18+,19+,22?,23+,24+,25+,26+/m1/s1 |
| InChIKey | WBPQFYDQWBGJTB-JEJCAQHWSA-N |
| XLogP | 3.81 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|