C29H38ClFO7 — CID 14860765
5-O-[(8S,9R,10S,11S,13S,14S,16S,17R)-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 1-O-ethyl pentanedioate (PubChem CID 14860765) has the molecular formula C29H38ClFO7 and a molecular weight of 553.07 g/mol. Its IUPAC name is 5-O-[(8S,9R,10S,11S,13S,14S,16S,17R)-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 1-O-ethyl pentanedioate.
| Compound Name | 5-O-[(8S,9R,10S,11S,13S,14S,16S,17R)-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 1-O-ethyl pentanedioate |
|---|---|
| PubChem CID | 14860765 |
| Molecular Formula | C29H38ClFO7 |
| Molecular Weight | 553.07 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 5-O-[(8S,9R,10S,11S,13S,14S,16S,17R)-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 1-O-ethyl pentanedioate |
| SMILES | CCOC(=O)CCCC(=O)O[C@]1(C(=O)CCl)[C@@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C29H38ClFO7/c1-5-37-24(35)7-6-8-25(36)38-29(23(34)16-30)17(2)13-21-20-10-9-18-14-19(32)11-12-26(18,3)28(20,31)22(33)15-27(21,29)4/h11-12,14,17,20-22,33H,5-10,13,15-16H2,1-4H3/t17-,20-,21-,22-,26-,27-,28-,29-/m0/s1 |
| InChIKey | OLGIWXISMDCNKB-REGDIAEZSA-N |
| XLogP | 4.43 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.07 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|