C26H31ClFNO5 — CID 14860756
[(8S,9R,10S,11S,13S,14S,16S,17R)-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 3-cyanopropanoate (PubChem CID 14860756) has the molecular formula C26H31ClFNO5 and a molecular weight of 491.99 g/mol. Its IUPAC name is [(8S,9R,10S,11S,13S,14S,16S,17R)-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 3-cyanopropanoate.
| Compound Name | [(8S,9R,10S,11S,13S,14S,16S,17R)-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 3-cyanopropanoate |
|---|---|
| PubChem CID | 14860756 |
| Molecular Formula | C26H31ClFNO5 |
| Molecular Weight | 491.99 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | [(8S,9R,10S,11S,13S,14S,16S,17R)-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 3-cyanopropanoate |
| SMILES | C[C@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@@]1(OC(=O)CCC#N)C(=O)CCl |
| InChI | InChI=1S/C26H31ClFNO5/c1-15-11-19-18-7-6-16-12-17(30)8-9-23(16,2)25(18,28)20(31)13-24(19,3)26(15,21(32)14-27)34-22(33)5-4-10-29/h8-9,12,15,18-20,31H,4-7,11,13-14H2,1-3H3/t15-,18-,19-,20-,23-,24-,25-,26-/m0/s1 |
| InChIKey | LVXPBEZHZZIQHO-SOMXGXJRSA-N |
| XLogP | 4.00 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.99 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|