C27H34ClFO7 — CID 88636494
1-O-[(8S,9R,10S,13S,14S,17R)-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 3-O-methyl 2-methylpropanedioate (PubChem CID 88636494) has the molecular formula C27H34ClFO7 and a molecular weight of 525.01 g/mol. Its IUPAC name is 1-O-[(8S,9R,10S,13S,14S,17R)-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 3-O-methyl 2-methylpropanedioate.
| Compound Name | 1-O-[(8S,9R,10S,13S,14S,17R)-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 3-O-methyl 2-methylpropanedioate |
|---|---|
| PubChem CID | 88636494 |
| Molecular Formula | C27H34ClFO7 |
| Molecular Weight | 525.01 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 1-O-[(8S,9R,10S,13S,14S,17R)-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 3-O-methyl 2-methylpropanedioate |
| SMILES | COC(=O)C(C)C(=O)O[C@]1(C(=O)CCl)C(C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)C(O)C[C@@]21C |
| InChI | InChI=1S/C27H34ClFO7/c1-14-10-19-18-7-6-16-11-17(30)8-9-24(16,3)26(18,29)20(31)12-25(19,4)27(14,21(32)13-28)36-23(34)15(2)22(33)35-5/h8-9,11,14-15,18-20,31H,6-7,10,12-13H2,1-5H3/t14?,15?,18-,19-,20?,24-,25-,26-,27-/m0/s1 |
| InChIKey | FKNMVOVIINXTBC-LGFVKNMTSA-N |
| XLogP | 3.50 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.01 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|