C25H33FO5S — CID 12962441
(8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-17-(2-methylpropanoyloxy)-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 12962441) has the molecular formula C25H33FO5S and a molecular weight of 464.60 g/mol. Its IUPAC name is (8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-17-(2-methylpropanoyloxy)-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | (8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-17-(2-methylpropanoyloxy)-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 12962441 |
| Molecular Formula | C25H33FO5S |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | (8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-17-(2-methylpropanoyloxy)-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | CC(C)C(=O)O[C@]1(C(=O)S)[C@@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C25H33FO5S/c1-13(2)20(29)31-25(21(30)32)14(3)10-18-17-7-6-15-11-16(27)8-9-22(15,4)24(17,26)19(28)12-23(18,25)5/h8-9,11,13-14,17-19,28H,6-7,10,12H2,1-5H3,(H,30,32)/t14-,17-,18-,19-,22-,23-,24-,25-/m0/s1 |
| InChIKey | CIWFEXGRWZZKTR-XGQKBEPLSA-N |
| XLogP | 4.00 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|