C24H28Cl2F2O6 — CID 18394587
fluoromethyl (8S,9R,10S,11S,13S,14S,16S,17R)-17-(2,2-dichloroacetyl)oxy-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 18394587) has the molecular formula C24H28Cl2F2O6 and a molecular weight of 521.38 g/mol. Its IUPAC name is fluoromethyl (8S,9R,10S,11S,13S,14S,16S,17R)-17-(2,2-dichloroacetyl)oxy-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | fluoromethyl (8S,9R,10S,11S,13S,14S,16S,17R)-17-(2,2-dichloroacetyl)oxy-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 18394587 |
| Molecular Formula | C24H28Cl2F2O6 |
| Molecular Weight | 521.38 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | fluoromethyl (8S,9R,10S,11S,13S,14S,16S,17R)-17-(2,2-dichloroacetyl)oxy-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | C[C@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@@]1(OC(=O)C(Cl)Cl)C(=O)OCF |
| InChI | InChI=1S/C24H28Cl2F2O6/c1-12-8-16-15-5-4-13-9-14(29)6-7-21(13,2)23(15,28)17(30)10-22(16,3)24(12,20(32)33-11-27)34-19(31)18(25)26/h6-7,9,12,15-18,30H,4-5,8,10-11H2,1-3H3/t12-,15-,16-,17-,21-,22-,23-,24-/m0/s1 |
| InChIKey | MLWUAYOFSAQXBX-HLQNMLRSSA-N |
| XLogP | 4.16 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|