C24H29Cl2FO6 — CID 137363234
methyl (8S,9R,10S,11S,13S,14S,16S,17S)-17-(2,2-dichloroacetyl)oxy-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 137363234) has the molecular formula C24H29Cl2FO6 and a molecular weight of 503.39 g/mol. Its IUPAC name is methyl (8S,9R,10S,11S,13S,14S,16S,17S)-17-(2,2-dichloroacetyl)oxy-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | methyl (8S,9R,10S,11S,13S,14S,16S,17S)-17-(2,2-dichloroacetyl)oxy-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 137363234 |
| Molecular Formula | C24H29Cl2FO6 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | methyl (8S,9R,10S,11S,13S,14S,16S,17S)-17-(2,2-dichloroacetyl)oxy-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | COC(=O)[C@]1(OC(=O)C(Cl)Cl)[C@@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C24H29Cl2FO6/c1-12-9-16-15-6-5-13-10-14(28)7-8-21(13,2)23(15,27)17(29)11-22(16,3)24(12,20(31)32-4)33-19(30)18(25)26/h7-8,10,12,15-18,29H,5-6,9,11H2,1-4H3/t12-,15-,16-,17-,21-,22-,23-,24+/m0/s1 |
| InChIKey | QMTJTPMTNVSKNJ-WIXANMDZSA-N |
| XLogP | 3.86 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|