C29H36FNO5 — CID 15607997
9-fluoro-11,17-dihydroxy-N-[(4-methoxyphenyl)methyl]-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 15607997) has the molecular formula C29H36FNO5 and a molecular weight of 497.61 g/mol. Its IUPAC name is 9-fluoro-11,17-dihydroxy-N-[(4-methoxyphenyl)methyl]-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | 9-fluoro-11,17-dihydroxy-N-[(4-methoxyphenyl)methyl]-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 15607997 |
| Molecular Formula | C29H36FNO5 |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 9-fluoro-11,17-dihydroxy-N-[(4-methoxyphenyl)methyl]-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | COc1ccc(CNC(=O)C2(O)C(C)CC3C4CCC5=CC(=O)C=CC5(C)C4(F)C(O)CC32C)cc1 |
| InChI | InChI=1S/C29H36FNO5/c1-17-13-23-22-10-7-19-14-20(32)11-12-26(19,2)28(22,30)24(33)15-27(23,3)29(17,35)25(34)31-16-18-5-8-21(36-4)9-6-18/h5-6,8-9,11-12,14,17,22-24,33,35H,7,10,13,15-16H2,1-4H3,(H,31,34) |
| InChIKey | PJSBDXWKMAAAMG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |