C28H42FNO4 — CID 140941647
(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-N-heptyl-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 140941647) has the molecular formula C28H42FNO4 and a molecular weight of 475.65 g/mol. Its IUPAC name is (8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-N-heptyl-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | (8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-N-heptyl-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 140941647 |
| Molecular Formula | C28H42FNO4 |
| Molecular Weight | 475.65 g/mol |
| Exact Mass | 475.31 |
| IUPAC Name | (8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-N-heptyl-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CCCCCCCNC(=O)[C@@]1(O)[C@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C28H42FNO4/c1-5-6-7-8-9-14-30-24(33)28(34)18(2)15-22-21-11-10-19-16-20(31)12-13-25(19,3)27(21,29)23(32)17-26(22,28)4/h12-13,16,18,21-23,32,34H,5-11,14-15,17H2,1-4H3,(H,30,33)/t18-,21+,22+,23+,25+,26+,27+,28+/m1/s1 |
| InChIKey | SMCYLCNSSZXXOC-YHLLFSIBSA-N |
| XLogP | 4.42 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.65 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|