C31H40FNO6 — CID 123142831
9-fluoro-11,17-dihydroxy-N-[3-(4-methoxyphenoxy)propyl]-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 123142831) has the molecular formula C31H40FNO6 and a molecular weight of 541.66 g/mol. Its IUPAC name is 9-fluoro-11,17-dihydroxy-N-[3-(4-methoxyphenoxy)propyl]-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | 9-fluoro-11,17-dihydroxy-N-[3-(4-methoxyphenoxy)propyl]-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 123142831 |
| Molecular Formula | C31H40FNO6 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | 9-fluoro-11,17-dihydroxy-N-[3-(4-methoxyphenoxy)propyl]-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | COc1ccc(OCCCNC(=O)C2(O)C(C)CC3C4CCC5=CC(=O)C=CC5(C)C4(F)C(O)CC32C)cc1 |
| InChI | InChI=1S/C31H40FNO6/c1-19-16-25-24-11-6-20-17-21(34)12-13-28(20,2)30(24,32)26(35)18-29(25,3)31(19,37)27(36)33-14-5-15-39-23-9-7-22(38-4)8-10-23/h7-10,12-13,17,19,24-26,35,37H,5-6,11,14-16,18H2,1-4H3,(H,33,36) |
| InChIKey | XZJOEHWPVIPEOG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|