C30H35FN2O6 — CID 123685811
N-[2-(1,3-benzoxazol-2-yloxy)ethyl]-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 123685811) has the molecular formula C30H35FN2O6 and a molecular weight of 538.62 g/mol. Its IUPAC name is N-[2-(1,3-benzoxazol-2-yloxy)ethyl]-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | N-[2-(1,3-benzoxazol-2-yloxy)ethyl]-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 123685811 |
| Molecular Formula | C30H35FN2O6 |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | N-[2-(1,3-benzoxazol-2-yloxy)ethyl]-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)NCCOc1nc2ccccc2o1 |
| InChI | InChI=1S/C30H35FN2O6/c1-17-14-21-20-9-8-18-15-19(34)10-11-27(18,2)29(20,31)24(35)16-28(21,3)30(17,37)25(36)32-12-13-38-26-33-22-6-4-5-7-23(22)39-26/h4-7,10-11,15,17,20-21,24,35,37H,8-9,12-14,16H2,1-3H3,(H,32,36) |
| InChIKey | RYAUTRCEJZRODD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|