C30H38FNO5 — CID 123271942
9-fluoro-11,17-dihydroxy-N-[3-(2-hydroxyphenyl)propyl]-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 123271942) has the molecular formula C30H38FNO5 and a molecular weight of 511.63 g/mol. Its IUPAC name is 9-fluoro-11,17-dihydroxy-N-[3-(2-hydroxyphenyl)propyl]-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | 9-fluoro-11,17-dihydroxy-N-[3-(2-hydroxyphenyl)propyl]-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 123271942 |
| Molecular Formula | C30H38FNO5 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | 9-fluoro-11,17-dihydroxy-N-[3-(2-hydroxyphenyl)propyl]-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)NCCCc1ccccc1O |
| InChI | InChI=1S/C30H38FNO5/c1-18-15-23-22-11-10-20-16-21(33)12-13-27(20,2)29(22,31)25(35)17-28(23,3)30(18,37)26(36)32-14-6-8-19-7-4-5-9-24(19)34/h4-5,7,9,12-13,16,18,22-23,25,34-35,37H,6,8,10-11,14-15,17H2,1-3H3,(H,32,36) |
| InChIKey | AZFFTUDZKRZAJP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|