C25H36FNO4 — CID 15607935
N-butyl-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 15607935) has the molecular formula C25H36FNO4 and a molecular weight of 433.56 g/mol. Its IUPAC name is N-butyl-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | N-butyl-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 15607935 |
| Molecular Formula | C25H36FNO4 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | N-butyl-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CCCCNC(=O)C1(O)C(C)CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC21C |
| InChI | InChI=1S/C25H36FNO4/c1-5-6-11-27-21(30)25(31)15(2)12-19-18-8-7-16-13-17(28)9-10-22(16,3)24(18,26)20(29)14-23(19,25)4/h9-10,13,15,18-20,29,31H,5-8,11-12,14H2,1-4H3,(H,27,30) |
| InChIKey | MICKNHUPLQXEJP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|