C25H33FO7 — CID 59809883
CID 59809883 (PubChem CID 59809883) has the molecular formula C25H33FO7 and a molecular weight of 464.53 g/mol.
| Compound Name | CID 59809883 |
|---|---|
| PubChem CID | 59809883 |
| Molecular Formula | C25H33FO7 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | — |
| SMILES | C[C@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C(C=O)C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@]12OCOC21COCO1 |
| InChI | InChI=1S/C25H33FO7/c1-14-6-18-17-5-4-16-7-19(28)15(10-27)8-21(16,2)24(17,26)20(29)9-22(18,3)25(14)23(32-13-33-25)11-30-12-31-23/h7,10,14-15,17-18,20,29H,4-6,8-9,11-13H2,1-3H3/t14-,15?,17-,18-,20-,21-,22-,23?,24-,25+/m0/s1 |
| InChIKey | ZUDYDZZHBMRXAP-OLPHIQTASA-N |
| XLogP | 2.70 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|