C21H27FO5S — CID 91483573
9-fluoro-2-formyl-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 91483573) has the molecular formula C21H27FO5S and a molecular weight of 410.51 g/mol. Its IUPAC name is 9-fluoro-2-formyl-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | 9-fluoro-2-formyl-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 91483573 |
| Molecular Formula | C21H27FO5S |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 9-fluoro-2-formyl-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | CC12CC(C=O)C(=O)C=C1CCC1C3CCC(O)(C(=O)S)C3(C)CC(O)C12F |
| InChI | InChI=1S/C21H27FO5S/c1-18-8-11(10-23)15(24)7-12(18)3-4-14-13-5-6-20(27,17(26)28)19(13,2)9-16(25)21(14,18)22/h7,10-11,13-14,16,25,27H,3-6,8-9H2,1-2H3,(H,26,28) |
| InChIKey | SXOSJBBNBXGRKY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|