C22H29FO5S — CID 91607917
9-fluoro-2-formyl-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 91607917) has the molecular formula C22H29FO5S and a molecular weight of 424.53 g/mol. Its IUPAC name is 9-fluoro-2-formyl-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | 9-fluoro-2-formyl-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 91607917 |
| Molecular Formula | C22H29FO5S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 9-fluoro-2-formyl-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | CC1CC2C3CCC4=CC(=O)C(C=O)CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)S |
| InChI | InChI=1S/C22H29FO5S/c1-11-6-15-14-5-4-13-7-16(25)12(10-24)8-19(13,2)21(14,23)17(26)9-20(15,3)22(11,28)18(27)29/h7,10-12,14-15,17,26,28H,4-6,8-9H2,1-3H3,(H,27,29) |
| InChIKey | QSBKULUFILINKY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|