C22H31FO4S — CID 88746953
[(8S,9S,10S,13S,14S)-9-fluoro-11-hydroxy-10,13,16,17-tetramethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]oxymethanethioic S-acid (PubChem CID 88746953) has the molecular formula C22H31FO4S and a molecular weight of 410.55 g/mol. Its IUPAC name is [(8S,9S,10S,13S,14S)-9-fluoro-11-hydroxy-10,13,16,17-tetramethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]oxymethanethioic S-acid.
| Compound Name | [(8S,9S,10S,13S,14S)-9-fluoro-11-hydroxy-10,13,16,17-tetramethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]oxymethanethioic S-acid |
|---|---|
| PubChem CID | 88746953 |
| Molecular Formula | C22H31FO4S |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | [(8S,9S,10S,13S,14S)-9-fluoro-11-hydroxy-10,13,16,17-tetramethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]oxymethanethioic S-acid |
| SMILES | CC1C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@]3(F)C(O)C[C@]2(C)C1(C)OC(=O)S |
| InChI | InChI=1S/C22H31FO4S/c1-12-9-16-15-6-5-13-10-14(24)7-8-19(13,2)22(15,23)17(25)11-20(16,3)21(12,4)27-18(26)28/h10,12,15-17,25H,5-9,11H2,1-4H3,(H,26,28)/t12?,15-,16-,17?,19-,20-,21?,22+/m0/s1 |
| InChIKey | WGMDHSUABRBPES-OZKUDWBFSA-N |
| XLogP | 4.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|