C23H37FO3Si — CID 6429868
(9R,17R)-9-fluoro-11-hydroxy-10,13,17-trimethyl-17-trimethylsilyloxy-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 6429868) has the molecular formula C23H37FO3Si and a molecular weight of 408.63 g/mol. Its IUPAC name is (9R,17R)-9-fluoro-11-hydroxy-10,13,17-trimethyl-17-trimethylsilyloxy-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (9R,17R)-9-fluoro-11-hydroxy-10,13,17-trimethyl-17-trimethylsilyloxy-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 6429868 |
| Molecular Formula | C23H37FO3Si |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | (9R,17R)-9-fluoro-11-hydroxy-10,13,17-trimethyl-17-trimethylsilyloxy-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC12CCC(=O)C=C1CCC1C3CC[C@@](C)(O[Si](C)(C)C)C3(C)CC(O)[C@@]12F |
| InChI | InChI=1S/C23H37FO3Si/c1-20-11-9-16(25)13-15(20)7-8-18-17-10-12-22(3,27-28(4,5)6)21(17,2)14-19(26)23(18,20)24/h13,17-19,26H,7-12,14H2,1-6H3/t17?,18?,19?,20?,21?,22-,23+/m1/s1 |
| InChIKey | NVWIQTIACUKQCC-CQCOEVKHSA-N |
| XLogP | 5.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|