C26H45FO3Si2 — CID 78409523
9-fluoro-10,13,17-trimethyl-11,17-bis(trimethylsilyloxy)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 78409523) has the molecular formula C26H45FO3Si2 and a molecular weight of 480.81 g/mol. Its IUPAC name is 9-fluoro-10,13,17-trimethyl-11,17-bis(trimethylsilyloxy)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 9-fluoro-10,13,17-trimethyl-11,17-bis(trimethylsilyloxy)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 78409523 |
| Molecular Formula | C26H45FO3Si2 |
| Molecular Weight | 480.81 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | 9-fluoro-10,13,17-trimethyl-11,17-bis(trimethylsilyloxy)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1(O[Si](C)(C)C)CCC2C3CCC4=CC(=O)CCC4(C)C3(F)C(O[Si](C)(C)C)CC21C |
| InChI | InChI=1S/C26H45FO3Si2/c1-23-14-12-19(28)16-18(23)10-11-21-20-13-15-25(3,30-32(7,8)9)24(20,2)17-22(26(21,23)27)29-31(4,5)6/h16,20-22H,10-15,17H2,1-9H3 |
| InChIKey | GEELRUKTAPOQJZ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.81 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|