C32H61FO4Si4 — CID 6430092
[(9R,11S,17S)-9-fluoro-10,13,17-trimethyl-3,6,11-tris(trimethylsilyloxy)-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane (PubChem CID 6430092) has the molecular formula C32H61FO4Si4 and a molecular weight of 641.18 g/mol. Its IUPAC name is [(9R,11S,17S)-9-fluoro-10,13,17-trimethyl-3,6,11-tris(trimethylsilyloxy)-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane.
| Compound Name | [(9R,11S,17S)-9-fluoro-10,13,17-trimethyl-3,6,11-tris(trimethylsilyloxy)-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 6430092 |
| Molecular Formula | C32H61FO4Si4 |
| Molecular Weight | 641.18 g/mol |
| Exact Mass | 640.36 |
| IUPAC Name | [(9R,11S,17S)-9-fluoro-10,13,17-trimethyl-3,6,11-tris(trimethylsilyloxy)-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
| SMILES | CC12C[C@H](O[Si](C)(C)C)[C@@]3(F)C(CC(O[Si](C)(C)C)=C4C=C(O[Si](C)(C)C)CCC43C)C1CC[C@]2(C)O[Si](C)(C)C |
| InChI | InChI=1S/C32H61FO4Si4/c1-29-18-16-23(34-38(4,5)6)20-26(29)27(35-39(7,8)9)21-25-24-17-19-31(3,37-41(13,14)15)30(24,2)22-28(32(25,29)33)36-40(10,11)12/h20,24-25,28H,16-19,21-22H2,1-15H3/t24?,25?,28-,29?,30?,31-,32-/m0/s1 |
| InChIKey | PDSJFWRYSJSVQU-QCCHXHMNSA-N |
| XLogP | 10.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.18 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|