C29H52O3Si3 — CID 6429863
trimethyl-[[(17R)-10,13,17-trimethyl-3,6-bis(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]oxy]silane (PubChem CID 6429863) has the molecular formula C29H52O3Si3 and a molecular weight of 532.99 g/mol. Its IUPAC name is trimethyl-[[(17R)-10,13,17-trimethyl-3,6-bis(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]oxy]silane.
| Compound Name | trimethyl-[[(17R)-10,13,17-trimethyl-3,6-bis(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]oxy]silane |
|---|---|
| PubChem CID | 6429863 |
| Molecular Formula | C29H52O3Si3 |
| Molecular Weight | 532.99 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | trimethyl-[[(17R)-10,13,17-trimethyl-3,6-bis(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]oxy]silane |
| SMILES | CC12C=CC(O[Si](C)(C)C)=CC1=C(O[Si](C)(C)C)CC1C2CCC2(C)C1CC[C@@]2(C)O[Si](C)(C)C |
| InChI | InChI=1S/C29H52O3Si3/c1-27-16-13-21(30-33(4,5)6)19-25(27)26(31-34(7,8)9)20-22-23(27)14-17-28(2)24(22)15-18-29(28,3)32-35(10,11)12/h13,16,19,22-24H,14-15,17-18,20H2,1-12H3/t22?,23?,24?,27?,28?,29-/m1/s1 |
| InChIKey | CBUDFJGEOLVXDB-DEQZDSFDSA-N |
| XLogP | 8.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.99 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|