C27H48O3Si2 — CID 22806942
(8R,9S,10S,13S,14S,17S)-6,13,17-trimethyl-17-trimethylsilyloxy-10-(trimethylsilyloxymethyl)-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 22806942) has the molecular formula C27H48O3Si2 and a molecular weight of 476.85 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S,17S)-6,13,17-trimethyl-17-trimethylsilyloxy-10-(trimethylsilyloxymethyl)-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10S,13S,14S,17S)-6,13,17-trimethyl-17-trimethylsilyloxy-10-(trimethylsilyloxymethyl)-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 22806942 |
| Molecular Formula | C27H48O3Si2 |
| Molecular Weight | 476.85 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | (8R,9S,10S,13S,14S,17S)-6,13,17-trimethyl-17-trimethylsilyloxy-10-(trimethylsilyloxymethyl)-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC1=C2CC(=O)CC[C@]2(CO[Si](C)(C)C)[C@H]2CC[C@@]3(C)[C@@H](CC[C@]3(C)O[Si](C)(C)C)[C@@H]2C1 |
| InChI | InChI=1S/C27H48O3Si2/c1-19-16-21-22-12-14-26(3,30-32(7,8)9)25(22,2)13-11-23(21)27(18-29-31(4,5)6)15-10-20(28)17-24(19)27/h21-23H,10-18H2,1-9H3/t21-,22-,23-,25-,26-,27-/m0/s1 |
| InChIKey | VNYUTTRVONOGPV-BWLCZPDMSA-N |
| XLogP | 7.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.85 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|