C26H41O3Si — CID 70605412
CID 70605412 (PubChem CID 70605412) has the molecular formula C26H41O3Si and a molecular weight of 429.70 g/mol.
| Compound Name | CID 70605412 |
|---|---|
| PubChem CID | 70605412 |
| Molecular Formula | C26H41O3Si |
| Molecular Weight | 429.70 g/mol |
| Exact Mass | 429.28 |
| IUPAC Name | — |
| SMILES | CC1=C2CC(=O)CC[C@]2(CC(C)(C)C)[C@H]2CC[C@]3(CO[Si](C)C)C(=O)CC[C@H]3[C@@H]2C1 |
| InChI | InChI=1S/C26H41O3Si/c1-17-13-19-20-7-8-23(28)26(20,16-29-30(5)6)12-10-21(19)25(15-24(2,3)4)11-9-18(27)14-22(17)25/h19-21H,7-16H2,1-6H3/t19-,20-,21-,25-,26+/m0/s1 |
| InChIKey | YUVXHSIXQNYZID-SUVMOZOHSA-N |
| XLogP | 6.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.70 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|