C19H29NO3 — CID 141192349
(6E,8R,9S,10R,13S,14S)-6-hydroxyimino-13-(hydroxymethyl)-10-methyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 141192349) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is (6E,8R,9S,10R,13S,14S)-6-hydroxyimino-13-(hydroxymethyl)-10-methyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (6E,8R,9S,10R,13S,14S)-6-hydroxyimino-13-(hydroxymethyl)-10-methyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 141192349 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (6E,8R,9S,10R,13S,14S)-6-hydroxyimino-13-(hydroxymethyl)-10-methyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCCCC1/C(=N/O)C[C@H]1[C@@H]3CCC(=O)[C@@]3(CO)CC[C@@H]12 |
| InChI | InChI=1S/C19H29NO3/c1-18-8-3-2-4-15(18)16(20-23)10-12-13(18)7-9-19(11-21)14(12)5-6-17(19)22/h12-15,21,23H,2-11H2,1H3/b20-16+/t12-,13+,14+,15?,18-,19-/m1/s1 |
| InChIKey | YSXXUKCGWOPNTI-SIQYCIEYSA-N |
| XLogP | 3.40 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|