C22H37N3O2 — CID 87725902
(6Z,8R,9R,10R,13S,14S)-3-(3-aminopropylamino)-6-hydroxyimino-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 87725902) has the molecular formula C22H37N3O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is (6Z,8R,9R,10R,13S,14S)-3-(3-aminopropylamino)-6-hydroxyimino-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (6Z,8R,9R,10R,13S,14S)-3-(3-aminopropylamino)-6-hydroxyimino-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 87725902 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | (6Z,8R,9R,10R,13S,14S)-3-(3-aminopropylamino)-6-hydroxyimino-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCC(NCCCN)CC1/C(=N\O)C[C@@H]1[C@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C22H37N3O2/c1-21-8-6-14(24-11-3-10-23)12-18(21)19(25-27)13-15-16-4-5-20(26)22(16,2)9-7-17(15)21/h14-18,24,27H,3-13,23H2,1-2H3/b25-19-/t14?,15-,16-,17+,18?,21+,22-/m0/s1 |
| InChIKey | WPIDSQWZXFSVBN-IVQAJLBFSA-N |
| XLogP | 3.35 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|