C24H38ClNO2 — CID 69133987
(8R,9R,10R,13S,14S)-3-(5-aminopent-1-enyl)-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6,17-dione;hydrochloride (PubChem CID 69133987) has the molecular formula C24H38ClNO2 and a molecular weight of 408.03 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-3-(5-aminopent-1-enyl)-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6,17-dione;hydrochloride.
| Compound Name | (8R,9R,10R,13S,14S)-3-(5-aminopent-1-enyl)-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6,17-dione;hydrochloride |
|---|---|
| PubChem CID | 69133987 |
| Molecular Formula | C24H38ClNO2 |
| Molecular Weight | 408.03 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | (8R,9R,10R,13S,14S)-3-(5-aminopent-1-enyl)-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6,17-dione;hydrochloride |
| SMILES | C[C@]12CCC(C=CCCCN)CC1C(=O)C[C@@H]1[C@H]2CC[C@]2(C)C(=O)CC[C@@H]12.Cl |
| InChI | InChI=1S/C24H37NO2.ClH/c1-23-11-9-16(6-4-3-5-13-25)14-20(23)21(26)15-17-18-7-8-22(27)24(18,2)12-10-19(17)23;/h4,6,16-20H,3,5,7-15,25H2,1-2H3;1H/t16?,17-,18-,19+,20?,23+,24-;/m0./s1 |
| InChIKey | RGDQINRDEQQDDB-IKZBDTTISA-N |
| XLogP | 5.11 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.03 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|