C23H33N3O2 — CID 141192418
(3R,8R,9S,10R,13S,14S)-3-[(Z)-4-azidobut-1-enyl]-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6,17-dione (PubChem CID 141192418) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is (3R,8R,9S,10R,13S,14S)-3-[(Z)-4-azidobut-1-enyl]-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6,17-dione.
| Compound Name | (3R,8R,9S,10R,13S,14S)-3-[(Z)-4-azidobut-1-enyl]-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6,17-dione |
|---|---|
| PubChem CID | 141192418 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | (3R,8R,9S,10R,13S,14S)-3-[(Z)-4-azidobut-1-enyl]-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6,17-dione |
| SMILES | C[C@]12CC[C@@H](/C=C\CCN=[N+]=[N-])CC1C(=O)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C23H33N3O2/c1-22-10-8-15(5-3-4-12-25-26-24)13-19(22)20(27)14-16-17-6-7-21(28)23(17,2)11-9-18(16)22/h3,5,15-19H,4,6-14H2,1-2H3/b5-3-/t15-,16+,17+,18+,19?,22-,23+/m1/s1 |
| InChIKey | BRWKALNBCOMQDJ-IZTYATSZSA-N |
| XLogP | 5.65 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|