C19H28O2S — CID 87709538
(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-3-sulfanyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6,17-dione (PubChem CID 87709538) has the molecular formula C19H28O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S)-10,13-dimethyl-3-sulfanyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6,17-dione.
| Compound Name | (3S,8R,9S,10R,13S,14S)-10,13-dimethyl-3-sulfanyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6,17-dione |
|---|---|
| PubChem CID | 87709538 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S)-10,13-dimethyl-3-sulfanyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6,17-dione |
| SMILES | C[C@]12CC[C@H](S)CC1C(=O)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C19H28O2S/c1-18-7-5-11(22)9-15(18)16(20)10-12-13-3-4-17(21)19(13,2)8-6-14(12)18/h11-15,22H,3-10H2,1-2H3/t11-,12-,13-,14-,15?,18+,19-/m0/s1 |
| InChIKey | JNDMGXJBLVGMLZ-SGLQGMHTSA-N |
| XLogP | 4.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|