C22H34N2O4 — CID 69134082
[(8R,9R,10R,13S,14S)-10,13-dimethyl-6,17-dioxo-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(2-aminoethyl)carbamate (PubChem CID 69134082) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is [(8R,9R,10R,13S,14S)-10,13-dimethyl-6,17-dioxo-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(2-aminoethyl)carbamate.
| Compound Name | [(8R,9R,10R,13S,14S)-10,13-dimethyl-6,17-dioxo-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(2-aminoethyl)carbamate |
|---|---|
| PubChem CID | 69134082 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | [(8R,9R,10R,13S,14S)-10,13-dimethyl-6,17-dioxo-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(2-aminoethyl)carbamate |
| SMILES | C[C@]12CCC(OC(=O)NCCN)CC1C(=O)C[C@@H]1[C@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C22H34N2O4/c1-21-7-5-13(28-20(27)24-10-9-23)11-17(21)18(25)12-14-15-3-4-19(26)22(15,2)8-6-16(14)21/h13-17H,3-12,23H2,1-2H3,(H,24,27)/t13?,14-,15-,16+,17?,21+,22-/m0/s1 |
| InChIKey | BSEPUHDUSKECIM-RRDYIODCSA-N |
| XLogP | 2.83 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |