C23H38ClN3O3 — CID 46906425
(3E,5S,6E,8R,9S,10R,13S,14S)-6-hydroxyimino-10,13-dimethyl-3-[3-(methylamino)propoxyimino]-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one;hydrochloride (PubChem CID 46906425) has the molecular formula C23H38ClN3O3 and a molecular weight of 440.03 g/mol. Its IUPAC name is (3E,5S,6E,8R,9S,10R,13S,14S)-6-hydroxyimino-10,13-dimethyl-3-[3-(methylamino)propoxyimino]-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one;hydrochloride.
| Compound Name | (3E,5S,6E,8R,9S,10R,13S,14S)-6-hydroxyimino-10,13-dimethyl-3-[3-(methylamino)propoxyimino]-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one;hydrochloride |
|---|---|
| PubChem CID | 46906425 |
| Molecular Formula | C23H38ClN3O3 |
| Molecular Weight | 440.03 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | (3E,5S,6E,8R,9S,10R,13S,14S)-6-hydroxyimino-10,13-dimethyl-3-[3-(methylamino)propoxyimino]-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one;hydrochloride |
| SMILES | CNCCCO/N=C1\CC[C@@]2(C)[C@H](C1)/C(=N/O)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12.Cl |
| InChI | InChI=1S/C23H37N3O3.ClH/c1-22-9-7-15(26-29-12-4-11-24-3)13-19(22)20(25-28)14-16-17-5-6-21(27)23(17,2)10-8-18(16)22;/h16-19,24,28H,4-14H2,1-3H3;1H/b25-20+,26-15+;/t16-,17-,18-,19+,22+,23-;/m0./s1 |
| InChIKey | YNZJCEAGJAHPCP-MCLFNWTDSA-N |
| XLogP | 4.44 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.03 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|