C22H37ClN2O2 — CID 24878009
(1S,2S,5Z,11R,12S,16S)-5-(2-aminoethoxyimino)-2,16-dimethyltetracyclo[9.7.0.02,7.012,16]octadecan-15-one;hydrochloride (PubChem CID 24878009) has the molecular formula C22H37ClN2O2 and a molecular weight of 397.00 g/mol. Its IUPAC name is (1S,2S,5Z,11R,12S,16S)-5-(2-aminoethoxyimino)-2,16-dimethyltetracyclo[9.7.0.02,7.012,16]octadecan-15-one;hydrochloride.
| Compound Name | (1S,2S,5Z,11R,12S,16S)-5-(2-aminoethoxyimino)-2,16-dimethyltetracyclo[9.7.0.02,7.012,16]octadecan-15-one;hydrochloride |
|---|---|
| PubChem CID | 24878009 |
| Molecular Formula | C22H37ClN2O2 |
| Molecular Weight | 397.00 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (1S,2S,5Z,11R,12S,16S)-5-(2-aminoethoxyimino)-2,16-dimethyltetracyclo[9.7.0.02,7.012,16]octadecan-15-one;hydrochloride |
| SMILES | C[C@]12CC/C(=N/OCCN)CC1CCC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12.Cl |
| InChI | InChI=1S/C22H36N2O2.ClH/c1-21-10-8-16(24-26-13-12-23)14-15(21)4-3-5-17-18-6-7-20(25)22(18,2)11-9-19(17)21;/h15,17-19H,3-14,23H2,1-2H3;1H/b24-16-;/t15?,17-,18-,19-,21-,22-;/m0./s1 |
| InChIKey | QKIQRJOBHQFVEL-HXVPFNCMSA-N |
| XLogP | 4.74 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.00 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|