C23H33N3O2 — CID 87709806
(2E)-2-[(10R,13S)-3-(2-aminoethoxyimino)-10,13-dimethyl-17-oxo-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-6-ylidene]acetonitrile (PubChem CID 87709806) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is (2E)-2-[(10R,13S)-3-(2-aminoethoxyimino)-10,13-dimethyl-17-oxo-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-6-ylidene]acetonitrile.
| Compound Name | (2E)-2-[(10R,13S)-3-(2-aminoethoxyimino)-10,13-dimethyl-17-oxo-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-6-ylidene]acetonitrile |
|---|---|
| PubChem CID | 87709806 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | (2E)-2-[(10R,13S)-3-(2-aminoethoxyimino)-10,13-dimethyl-17-oxo-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-6-ylidene]acetonitrile |
| SMILES | C[C@]12CCC(=NOCCN)CC1/C(=C/C#N)CC1C2CC[C@]2(C)C(=O)CCC12 |
| InChI | InChI=1S/C23H33N3O2/c1-22-8-5-16(26-28-12-11-25)14-20(22)15(7-10-24)13-17-18-3-4-21(27)23(18,2)9-6-19(17)22/h7,17-20H,3-6,8-9,11-14,25H2,1-2H3/b15-7+,26-16?/t17?,18?,19?,20?,22-,23+/m1/s1 |
| InChIKey | MCGKRYRVSRWXQV-LFJQNNHYSA-N |
| XLogP | 3.99 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|