C25H37N3O3 — CID 123989211
(10S,13S)-3-[2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethoxyimino]-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 123989211) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is (10S,13S)-3-[2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethoxyimino]-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (10S,13S)-3-[2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethoxyimino]-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 123989211 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | (10S,13S)-3-[2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethoxyimino]-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCC(=NOCCc3cc(CN)on3)CC1CCC1C2CC[C@]2(C)C(=O)CCC12 |
| InChI | InChI=1S/C25H37N3O3/c1-24-10-7-17(27-30-12-9-18-14-19(15-26)31-28-18)13-16(24)3-4-20-21-5-6-23(29)25(21,2)11-8-22(20)24/h14,16,20-22H,3-13,15,26H2,1-2H3/t16?,20?,21?,22?,24-,25-/m0/s1 |
| InChIKey | WEHDAHOWSAJYDP-ZPSIEQECSA-N |
| XLogP | 4.66 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|