C24H37N3O3 — CID 123438702
(10S,13S,17S)-10,13-dimethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethoxyimino]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 123438702) has the molecular formula C24H37N3O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is (10S,13S,17S)-10,13-dimethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethoxyimino]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (10S,13S,17S)-10,13-dimethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethoxyimino]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 123438702 |
| Molecular Formula | C24H37N3O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | (10S,13S,17S)-10,13-dimethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethoxyimino]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | Cc1noc(CCON=C2CC[C@@]3(C)C(CCC4C3CC[C@@]3(C)C4CC[C@@H]3O)C2)n1 |
| InChI | InChI=1S/C24H37N3O3/c1-15-25-22(30-26-15)10-13-29-27-17-8-11-23(2)16(14-17)4-5-18-19-6-7-21(28)24(19,3)12-9-20(18)23/h16,18-21,28H,4-14H2,1-3H3/t16?,18?,19?,20?,21-,23-,24-/m0/s1 |
| InChIKey | LQPLHWVEGKCYEM-NETAULNESA-N |
| XLogP | 4.70 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|