C24H38N2O2 — CID 88898381
(3Z,10S,13S)-10,13-dimethyl-3-[(3S)-1-methylpyrrolidin-3-yl]oxyimino-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 88898381) has the molecular formula C24H38N2O2 and a molecular weight of 386.58 g/mol. Its IUPAC name is (3Z,10S,13S)-10,13-dimethyl-3-[(3S)-1-methylpyrrolidin-3-yl]oxyimino-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3Z,10S,13S)-10,13-dimethyl-3-[(3S)-1-methylpyrrolidin-3-yl]oxyimino-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 88898381 |
| Molecular Formula | C24H38N2O2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | (3Z,10S,13S)-10,13-dimethyl-3-[(3S)-1-methylpyrrolidin-3-yl]oxyimino-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CN1CC[C@H](O/N=C2/CC[C@@]3(C)C(CCC4C3CC[C@]3(C)C(=O)CCC43)C2)C1 |
| InChI | InChI=1S/C24H38N2O2/c1-23-11-8-17(25-28-18-10-13-26(3)15-18)14-16(23)4-5-19-20-6-7-22(27)24(20,2)12-9-21(19)23/h16,18-21H,4-15H2,1-3H3/b25-17-/t16?,18-,19?,20?,21?,23-,24-/m0/s1 |
| InChIKey | PLPAASMCADGPDP-KOOFFBTJSA-N |
| XLogP | 4.67 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|