C23H36N2O3 — CID 56650242
(3E,10R,13S)-10-(hydroxymethyl)-13-methyl-3-pyrrolidin-3-yloxyimino-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 56650242) has the molecular formula C23H36N2O3 and a molecular weight of 388.55 g/mol. Its IUPAC name is (3E,10R,13S)-10-(hydroxymethyl)-13-methyl-3-pyrrolidin-3-yloxyimino-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3E,10R,13S)-10-(hydroxymethyl)-13-methyl-3-pyrrolidin-3-yloxyimino-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 56650242 |
| Molecular Formula | C23H36N2O3 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.27 |
| IUPAC Name | (3E,10R,13S)-10-(hydroxymethyl)-13-methyl-3-pyrrolidin-3-yloxyimino-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCC3C(CCC4C/C(=N/OC5CCNC5)CC[C@@]43CO)C1CCC2=O |
| InChI | InChI=1S/C23H36N2O3/c1-22-9-7-20-18(19(22)4-5-21(22)27)3-2-15-12-16(6-10-23(15,20)14-26)25-28-17-8-11-24-13-17/h15,17-20,24,26H,2-14H2,1H3/b25-16+/t15?,17?,18?,19?,20?,22-,23+/m0/s1 |
| InChIKey | MJZQVGJJPZNDGF-UJCQKHTJSA-N |
| XLogP | 3.31 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|