C27H38N2O7 — CID 87653108
(E)-but-2-enedioic acid;(8R,9S,10S,13S,14S)-10,13-dimethyl-3-[(3S)-pyrrolidin-3-yl]oxyimino-1,2,4,5,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7,17-dione (PubChem CID 87653108) has the molecular formula C27H38N2O7 and a molecular weight of 502.61 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(8R,9S,10S,13S,14S)-10,13-dimethyl-3-[(3S)-pyrrolidin-3-yl]oxyimino-1,2,4,5,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7,17-dione.
| Compound Name | (E)-but-2-enedioic acid;(8R,9S,10S,13S,14S)-10,13-dimethyl-3-[(3S)-pyrrolidin-3-yl]oxyimino-1,2,4,5,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7,17-dione |
|---|---|
| PubChem CID | 87653108 |
| Molecular Formula | C27H38N2O7 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | (E)-but-2-enedioic acid;(8R,9S,10S,13S,14S)-10,13-dimethyl-3-[(3S)-pyrrolidin-3-yl]oxyimino-1,2,4,5,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7,17-dione |
| SMILES | C[C@]12CCC(=NO[C@H]3CCNC3)CC1CC(=O)[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C23H34N2O3.C4H4O4/c1-22-8-5-15(25-28-16-7-10-24-13-16)11-14(22)12-19(26)21-17-3-4-20(27)23(17,2)9-6-18(21)22;5-3(6)1-2-4(7)8/h14,16-18,21,24H,3-13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t14?,16-,17-,18-,21-,22-,23-;/m0./s1 |
| InChIKey | HTJHAQDLLYVMNE-LSVVFYIASA-N |
| XLogP | 3.22 |
| TPSA | 142.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|