C27H38N2O8 — CID 87200780
(E)-but-2-enedioic acid;(1S,2R,5E,11R,12S,16S)-2,16-dimethyl-5-[(3R)-pyrrolidin-3-yl]oxyimino-8-oxatetracyclo[9.7.0.02,7.012,16]octadecane-9,15-dione (PubChem CID 87200780) has the molecular formula C27H38N2O8 and a molecular weight of 518.61 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(1S,2R,5E,11R,12S,16S)-2,16-dimethyl-5-[(3R)-pyrrolidin-3-yl]oxyimino-8-oxatetracyclo[9.7.0.02,7.012,16]octadecane-9,15-dione.
| Compound Name | (E)-but-2-enedioic acid;(1S,2R,5E,11R,12S,16S)-2,16-dimethyl-5-[(3R)-pyrrolidin-3-yl]oxyimino-8-oxatetracyclo[9.7.0.02,7.012,16]octadecane-9,15-dione |
|---|---|
| PubChem CID | 87200780 |
| Molecular Formula | C27H38N2O8 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | (E)-but-2-enedioic acid;(1S,2R,5E,11R,12S,16S)-2,16-dimethyl-5-[(3R)-pyrrolidin-3-yl]oxyimino-8-oxatetracyclo[9.7.0.02,7.012,16]octadecane-9,15-dione |
| SMILES | C[C@]12CC/C(=N\O[C@@H]3CCNC3)CC1OC(=O)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C23H34N2O4.C4H4O4/c1-22-9-6-18-16(17(22)3-4-19(22)26)12-21(27)28-20-11-14(5-8-23(18,20)2)25-29-15-7-10-24-13-15;5-3(6)1-2-4(7)8/h15-18,20,24H,3-13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b25-14+;2-1+/t15-,16+,17+,18+,20?,22+,23-;/m1./s1 |
| InChIKey | SGAPZNITFZPPQJ-DHDNIIHWSA-N |
| XLogP | 2.95 |
| TPSA | 151.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|