C24H38ClN3O3 — CID 46906373
(3E,5R,6S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-3-[(3R)-pyrrolidin-3-yl]oxyimino-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6-carboxamide;hydrochloride (PubChem CID 46906373) has the molecular formula C24H38ClN3O3 and a molecular weight of 452.04 g/mol. Its IUPAC name is (3E,5R,6S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-3-[(3R)-pyrrolidin-3-yl]oxyimino-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6-carboxamide;hydrochloride.
| Compound Name | (3E,5R,6S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-3-[(3R)-pyrrolidin-3-yl]oxyimino-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 46906373 |
| Molecular Formula | C24H38ClN3O3 |
| Molecular Weight | 452.04 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | (3E,5R,6S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-3-[(3R)-pyrrolidin-3-yl]oxyimino-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6-carboxamide;hydrochloride |
| SMILES | C[C@]12CC/C(=N\O[C@@H]3CCNC3)C[C@@H]1[C@@H](C(N)=O)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12.Cl |
| InChI | InChI=1S/C24H37N3O3.ClH/c1-23-8-5-14(27-30-15-7-10-26-13-15)11-20(23)17(22(25)29)12-16-18-3-4-21(28)24(18,2)9-6-19(16)23;/h15-20,26H,3-13H2,1-2H3,(H2,25,29);1H/b27-14+;/t15-,16+,17+,18+,19+,20-,23-,24+;/m1./s1 |
| InChIKey | BJRGLYRFOHXEMA-SPCBTVBZSA-N |
| XLogP | 3.47 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.04 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|