C26H38N2O4 — CID 56650922
[(3E,10S,13S)-13-methyl-6-methylidene-17-oxo-3-pyrrolidin-3-yloxyimino-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]methyl acetate (PubChem CID 56650922) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is [(3E,10S,13S)-13-methyl-6-methylidene-17-oxo-3-pyrrolidin-3-yloxyimino-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]methyl acetate.
| Compound Name | [(3E,10S,13S)-13-methyl-6-methylidene-17-oxo-3-pyrrolidin-3-yloxyimino-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]methyl acetate |
|---|---|
| PubChem CID | 56650922 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | [(3E,10S,13S)-13-methyl-6-methylidene-17-oxo-3-pyrrolidin-3-yloxyimino-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]methyl acetate |
| SMILES | C=C1CC2C(CC[C@]3(C)C(=O)CCC23)[C@@]2(COC(C)=O)CC/C(=N\OC3CCNC3)CC12 |
| InChI | InChI=1S/C26H38N2O4/c1-16-12-20-21-4-5-24(30)25(21,3)9-7-22(20)26(15-31-17(2)29)10-6-18(13-23(16)26)28-32-19-8-11-27-14-19/h19-23,27H,1,4-15H2,2-3H3/b28-18+/t19?,20?,21?,22?,23?,25-,26-/m0/s1 |
| InChIKey | XKNXUXZGZKLAQV-BTYMMUSQSA-N |
| XLogP | 4.04 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|