C20H29NO3 — CID 87436678
(8R,9S,10S,13S,14S)-2-methoxyimino-10,13-dimethyl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 87436678) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S)-2-methoxyimino-10,13-dimethyl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10S,13S,14S)-2-methoxyimino-10,13-dimethyl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 87436678 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (8R,9S,10S,13S,14S)-2-methoxyimino-10,13-dimethyl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CON=C1C[C@@]2(C)C(CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)CC1=O |
| InChI | InChI=1S/C20H29NO3/c1-19-9-8-15-13(14(19)6-7-18(19)23)5-4-12-10-17(22)16(21-24-3)11-20(12,15)2/h12-15H,4-11H2,1-3H3/t12?,13-,14-,15-,19-,20-/m0/s1 |
| InChIKey | GJTWUUYZRUHZRD-ARQPHWELSA-N |
| XLogP | 3.78 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|