C22H31NO3 — CID 87709773
(8R,9S,10S,13S,14S)-10,13-dimethyl-2-prop-2-enoxyimino-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 87709773) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S)-10,13-dimethyl-2-prop-2-enoxyimino-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10S,13S,14S)-10,13-dimethyl-2-prop-2-enoxyimino-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 87709773 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | (8R,9S,10S,13S,14S)-10,13-dimethyl-2-prop-2-enoxyimino-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C=CCON=C1C[C@@]2(C)C(CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)CC1=O |
| InChI | InChI=1S/C22H31NO3/c1-4-11-26-23-18-13-22(3)14(12-19(18)24)5-6-15-16-7-8-20(25)21(16,2)10-9-17(15)22/h4,14-17H,1,5-13H2,2-3H3/t14?,15-,16-,17-,21-,22-/m0/s1 |
| InChIKey | KVQSYGBHBZUXKD-ODPYALKHSA-N |
| XLogP | 4.34 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|