C25H40N2O2 — CID 123873788
(10S,13S)-3-[2-[2-(dimethylamino)ethoxyimino]ethylidene]-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 123873788) has the molecular formula C25H40N2O2 and a molecular weight of 400.61 g/mol. Its IUPAC name is (10S,13S)-3-[2-[2-(dimethylamino)ethoxyimino]ethylidene]-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (10S,13S)-3-[2-[2-(dimethylamino)ethoxyimino]ethylidene]-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 123873788 |
| Molecular Formula | C25H40N2O2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.31 |
| IUPAC Name | (10S,13S)-3-[2-[2-(dimethylamino)ethoxyimino]ethylidene]-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CN(C)CCON=CC=C1CC[C@@]2(C)C(CCC3C2CC[C@]2(C)C(=O)CCC32)C1 |
| InChI | InChI=1S/C25H40N2O2/c1-24-12-9-18(11-14-26-29-16-15-27(3)4)17-19(24)5-6-20-21-7-8-23(28)25(21,2)13-10-22(20)24/h11,14,19-22H,5-10,12-13,15-17H2,1-4H3/t19?,20?,21?,22?,24-,25-/m0/s1 |
| InChIKey | MRUPDXREWYMWIX-BMXVMXCGSA-N |
| XLogP | 5.09 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|