C25H42N2O2 — CID 88898284
(3E,10S,13S,17S)-3-[2-[2-(dimethylamino)ethoxyimino]ethylidene]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 88898284) has the molecular formula C25H42N2O2 and a molecular weight of 402.62 g/mol. Its IUPAC name is (3E,10S,13S,17S)-3-[2-[2-(dimethylamino)ethoxyimino]ethylidene]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (3E,10S,13S,17S)-3-[2-[2-(dimethylamino)ethoxyimino]ethylidene]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 88898284 |
| Molecular Formula | C25H42N2O2 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.32 |
| IUPAC Name | (3E,10S,13S,17S)-3-[2-[2-(dimethylamino)ethoxyimino]ethylidene]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | CN(C)CCON=C/C=C1\CC[C@@]2(C)C(CCC3C2CC[C@@]2(C)C3CC[C@@H]2O)C1 |
| InChI | InChI=1S/C25H42N2O2/c1-24-12-9-18(11-14-26-29-16-15-27(3)4)17-19(24)5-6-20-21-7-8-23(28)25(21,2)13-10-22(20)24/h11,14,19-23,28H,5-10,12-13,15-17H2,1-4H3/b18-11+,26-14?/t19?,20?,21?,22?,23-,24-,25-/m0/s1 |
| InChIKey | VSFWBCHSTNEJNY-GRXZJMRHSA-N |
| XLogP | 4.88 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|