C22H36N2O2 — CID 123607537
(3S,10S,13S)-3-(2-aminoethoxyiminomethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 123607537) has the molecular formula C22H36N2O2 and a molecular weight of 360.54 g/mol. Its IUPAC name is (3S,10S,13S)-3-(2-aminoethoxyiminomethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3S,10S,13S)-3-(2-aminoethoxyiminomethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 123607537 |
| Molecular Formula | C22H36N2O2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | (3S,10S,13S)-3-(2-aminoethoxyiminomethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@H](C=NOCCN)CC1CCC1C2CC[C@]2(C)C(=O)CCC12 |
| InChI | InChI=1S/C22H36N2O2/c1-21-9-7-15(14-24-26-12-11-23)13-16(21)3-4-17-18-5-6-20(25)22(18,2)10-8-19(17)21/h14-19H,3-13,23H2,1-2H3/t15-,16?,17?,18?,19?,21-,22-/m0/s1 |
| InChIKey | OVYUEILDFLHCEQ-VQYBLUBBSA-N |
| XLogP | 4.18 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|