C26H44N2O2 — CID 123912965
3-[3-(2-amino-2-methylpropoxy)propylimino]-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 123912965) has the molecular formula C26H44N2O2 and a molecular weight of 416.65 g/mol. Its IUPAC name is 3-[3-(2-amino-2-methylpropoxy)propylimino]-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | 3-[3-(2-amino-2-methylpropoxy)propylimino]-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 123912965 |
| Molecular Formula | C26H44N2O2 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.34 |
| IUPAC Name | 3-[3-(2-amino-2-methylpropoxy)propylimino]-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC(C)(N)COCCC/N=C1\CCC2(C)C(CCC3C4CCC(=O)C4(C)CCC32)C1 |
| InChI | InChI=1S/C26H44N2O2/c1-24(2,27)17-30-15-5-14-28-19-10-12-25(3)18(16-19)6-7-20-21-8-9-23(29)26(21,4)13-11-22(20)25/h18,20-22H,5-17,27H2,1-4H3/b28-19+ |
| InChIKey | AMOLVUWLDFEQCL-TURZUDJPSA-N |
| XLogP | 5.18 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|